For research use only. Not for therapeutic Use.
Martinostat (hydrochloride)(CAT: I040213) is a potent inhibitor of histone deacetylases (HDACs), a class of enzymes that regulate gene expression through chromatin remodeling. It selectively targets Class I and Class IIb HDACs, making it a valuable molecular probe for epigenetic research and neuroimaging studies. Martinostat can be radiolabeled with isotopes such as ¹¹C or ¹⁸F, enabling non-invasive PET imaging of HDAC activity in vivo, particularly in the brain and heart. This compound is widely used in diagnostic and translational research to investigate HDAC-related pathologies, including cancer, neurodegenerative disorders, and cardiovascular diseases.
| Synonyms | (E)-3-[4-[[1-adamantylmethyl(methyl)amino]methyl]phenyl]-N-hydroxyprop-2-enamide;hydrochloride |
| Molecular Formula | C22H31ClN2O2 |
| Purity | ≥95% |
| IUPAC Name | (E)-3-[4-[[1-adamantylmethyl(methyl)amino]methyl]phenyl]-N-hydroxyprop-2-enamide;hydrochloride |
| InChI | InChI=1S/C22H30N2O2.ClH/c1-24(14-17-4-2-16(3-5-17)6-7-21(25)23-26)15-22-11-18-8-19(12-22)10-20(9-18)13-22;/h2-7,18-20,26H,8-15H2,1H3,(H,23,25);1H/b7-6+; |
| InChIKey | MRSVJZJSPMLBEO-UHDJGPCESA-N |
| SMILES | CN(CC1=CC=C(C=C1)C=CC(=O)NO)CC23CC4CC(C2)CC(C4)C3.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
