For research use only. Not for therapeutic Use.
Marein（Cat No.:I031541）is a flavonoid glycoside found in various medicinal plants, including Artemisia species. Structurally, it consists of a flavone backbone attached to a sugar moiety, typically glucose. Marein is known for its antioxidant, anti-inflammatory, and antimicrobial activities, making it a compound of interest in traditional medicine and pharmacology. It has been shown to exhibit protective effects against oxidative stress, reduce inflammation, and inhibit bacterial growth. Marein’s bioactivity supports its potential applications in the treatment of chronic diseases, skin disorders, and as an adjunct in integrative medicine for immune health.
| CAS Number | 535-96-6 |
| Synonyms | (E)-3-(3,4-dihydroxyphenyl)-1-[2,3-dihydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one |
| Molecular Formula | C21H22O11 |
| Purity | ≥95% |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-1-[2,3-dihydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-en-1-one |
| InChI | InChI=1S/C21H22O11/c22-8-15-18(28)19(29)20(30)21(32-15)31-14-6-3-10(16(26)17(14)27)11(23)4-1-9-2-5-12(24)13(25)7-9/h1-7,15,18-22,24-30H,8H2/b4-1+/t15-,18-,19+,20-,21-/m1/s1 |
| InChIKey | XGEYXJDOVMEJNG-HTFDPZBKSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)C2=C(C(=C(C=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
