For research use only. Not for therapeutic Use.
MAO-B-IN-8（Cat No.:I043825）is a selective inhibitor of monoamine oxidase B (MAO-B), an enzyme responsible for the breakdown of neurotransmitters like dopamine in the brain. By inhibiting MAO-B, this compound helps to increase dopamine levels, which can have therapeutic effects in treating neurodegenerative disorders such as Parkinson’s disease. MAO-B-IN-8 has shown potential in preclinical studies for improving motor function and reducing symptoms associated with dopamine depletion. Its specificity for MAO-B makes it a valuable tool in research aimed at developing targeted therapies for Parkinson’s and related neurodegenerative conditions.
| CAS Number | 1638956-60-1 |
| Synonyms | (2Z)-6-hydroxy-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-3-one |
| Molecular Formula | C18H16O6 |
| Purity | ≥95% |
| IUPAC Name | (2Z)-6-hydroxy-2-[(2,3,4-trimethoxyphenyl)methylidene]-1-benzofuran-3-one |
| InChI | InChI=1S/C18H16O6/c1-21-13-7-4-10(17(22-2)18(13)23-3)8-15-16(20)12-6-5-11(19)9-14(12)24-15/h4-9,19H,1-3H3/b15-8- |
| InChIKey | JGOPTESGPYJSBC-NVNXTCNLSA-N |
| SMILES | COC1=C(C(=C(C=C1)/C=C\2/C(=O)C3=C(O2)C=C(C=C3)O)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
