For research use only. Not for therapeutic Use.
Manganese(salen) chloride（Cat No.:I044759）is a coordination complex consisting of a manganese ion bound to a salen-type ligand (N,N’-bis(salicylidene)ethylenediamine) and a chloride counterion. This complex is widely studied for its oxidation catalytic activity, particularly in epoxidation of alkenes, asymmetric synthesis, and biomimetic oxidation reactions. It mimics the function of certain metalloenzymes and is used in both academic and industrial research to explore oxidative mechanisms. The chiral versions of manganese(salen) complexes have also been employed in enantioselective catalysis, making them valuable tools in green chemistry and fine chemical production.
| CAS Number | 53177-12-1 |
| Molecular Formula | C16H14ClMnN2O2 |
| Purity | ≥95% |
| IUPAC Name | manganese(3+);2-[2-[(2-oxidophenyl)methylideneamino]ethyliminomethyl]phenolate;chloride |
| InChI | InChI=1S/C16H16N2O2.ClH.Mn/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20;;/h1-8,11-12,19-20H,9-10H2;1H;/q;;+3/p-3 |
| InChIKey | HBQGFROGWOHBAG-UHFFFAOYSA-K |
| SMILES | C1=CC=C(C(=C1)C=NCCN=CC2=CC=CC=C2[O-])[O-].[Cl-].[Mn+3] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
