For research use only. Not for therapeutic Use.
MALAT1-IN-1（Cat No.:I017976）is a small-molecule inhibitor targeting the long non-coding RNA MALAT1 (Metastasis-Associated Lung Adenocarcinoma Transcript 1), a key regulator implicated in tumor progression and metastasis. By disrupting MALAT1 function, MALAT1-IN-1 modulates oncogenic signaling pathways, impairing cancer cell proliferation, migration, and invasion. It is widely applied in cancer biology research to explore RNA-targeted therapeutic strategies. Studies highlight its potential in lung, breast, and other malignancies where MALAT1 is overexpressed. MALAT1-IN-1 serves as a valuable tool for validating RNA-based drug discovery approaches and understanding metastasis regulation.
| CAS Number | 827327-28-6 |
| Synonyms | 5-(4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-1-methylimidazol-2-amine |
| Molecular Formula | C19H21N3O2 |
| Purity | ≥95% |
| IUPAC Name | 5-(4-methoxyphenyl)-N-[(3-methoxyphenyl)methyl]-1-methylimidazol-2-amine |
| InChI | InChI=1S/C19H21N3O2/c1-22-18(15-7-9-16(23-2)10-8-15)13-21-19(22)20-12-14-5-4-6-17(11-14)24-3/h4-11,13H,12H2,1-3H3,(H,20,21) |
| InChIKey | LCVOJBGSGIOMKF-UHFFFAOYSA-N |
| SMILES | CN1C(=CN=C1NCC2=CC(=CC=C2)OC)C3=CC=C(C=C3)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
