For research use only. Not for therapeutic Use.
Malabaricone C（Cat No.:I031470）is a bioactive phenolic compound isolated from the fruit rind of Myristica malabarica, known for its potent antioxidant, anti-inflammatory, and antimicrobial properties. It exerts strong free radical-scavenging activity and modulates key cellular pathways, including NF-κB and COX-2, contributing to its anti-inflammatory effects. Malabaricone C has shown potential in inhibiting cancer cell proliferation and inducing apoptosis, making it a promising candidate in anticancer research. Its broad-spectrum bioactivity supports its use in studying natural product-based therapeutics for chronic diseases involving oxidative stress, inflammation, and microbial infections.
| CAS Number | 63335-25-1 |
| Synonyms | 1-(2,6-dihydroxyphenyl)-9-(3,4-dihydroxyphenyl)nonan-1-one |
| Molecular Formula | C21H26O5 |
| Purity | ≥95% |
| IUPAC Name | 1-(2,6-dihydroxyphenyl)-9-(3,4-dihydroxyphenyl)nonan-1-one |
| InChI | InChI=1S/C21H26O5/c22-16-13-12-15(14-20(16)26)8-5-3-1-2-4-6-9-17(23)21-18(24)10-7-11-19(21)25/h7,10-14,22,24-26H,1-6,8-9H2 |
| InChIKey | HCOZRFYGIFMIEX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)C(=O)CCCCCCCCC2=CC(=C(C=C2)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
