For research use only. Not for therapeutic Use.
Mal-Ph-CONH-PEG4-NHS ester（Cat No.:I014925）is a heterobifunctional PEG linker widely used in bioconjugation and chemical biology. It features a maleimide group that selectively reacts with thiols, an NHS ester that couples efficiently with primary amines, and a PEG4 spacer that enhances solubility and reduces steric hindrance. This reagent enables stable covalent linkage of proteins, peptides, antibodies, or small molecules for probe development, labeling, and drug delivery research. Its versatile chemistry supports applications in antibody–drug conjugates, surface modification, and biomolecular engineering, making it an essential tool in chemical and biomedical research.
| CAS Number | 1263044-88-7 |
| Synonyms | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[3-(2,5-dioxopyrrol-1-yl)benzoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| Molecular Formula | C26H31N3O11 |
| Purity | ≥95% |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[3-(2,5-dioxopyrrol-1-yl)benzoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChI | InChI=1S/C26H31N3O11/c30-21-4-5-22(31)28(21)20-3-1-2-19(18-20)26(35)27-9-11-37-13-15-39-17-16-38-14-12-36-10-8-25(34)40-29-23(32)6-7-24(29)33/h1-5,18H,6-17H2,(H,27,35) |
| InChIKey | QDLKNPCHCJFKOJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)C2=CC(=CC=C2)N3C(=O)C=CC3=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
