For research use only. Not for therapeutic Use.
Mal-PEG5-NHS ester(CAT: I017126) is a heterobifunctional polyethylene glycol linker containing a maleimide group and an N-hydroxysuccinimide (NHS) ester, separated by a five-unit PEG spacer. The maleimide group selectively reacts with sulfhydryl (–SH) groups, while the NHS ester enables efficient coupling to primary amines, forming stable thioether and amide bonds. The PEG5 backbone improves solubility, enhances linker flexibility, and minimizes steric hindrance, ensuring efficient conjugation in aqueous environments. Mal-PEG5-NHS ester is widely applied in protein modification, antibody–drug conjugates (ADCs), peptide labeling, surface functionalization, and bioconjugation research, providing a versatile tool for controlled and site-specific biomolecular conjugation.
| CAS Number | 1807537-42-3 |
| Synonyms | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| Molecular Formula | C21H30N2O11 |
| Purity | ≥95% |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChI | InChI=1S/C21H30N2O11/c24-17-1-2-18(25)22(17)6-8-30-10-12-32-14-16-33-15-13-31-11-9-29-7-5-21(28)34-23-19(26)3-4-20(23)27/h1-2H,3-16H2 |
| InChIKey | PDFXZGGPCFZXJU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCN2C(=O)C=CC2=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
