For research use only. Not for therapeutic Use.
Mal-PEG4-acid(CAT:I017121) is a heterobifunctional polyethylene glycol linker containing a maleimide group and a terminal carboxylic acid, separated by a four-unit PEG spacer. The maleimide group enables site-specific conjugation to sulfhydryl (–SH) groups on proteins or peptides, while the carboxyl group can be activated for amide bond formation with primary amines. The PEG4 spacer enhances solubility, flexibility, and reduces steric hindrance, making it highly effective for bioconjugation applications. Mal-PEG4-acid is widely employed in the development of antibody–drug conjugates (ADCs), targeted drug delivery systems, surface functionalization, and chemical biology studies, where precise and stable linker chemistry is essential.
| CAS Number | 518044-41-2 |
| Synonyms | 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| Molecular Formula | C15H23NO8 |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C15H23NO8/c17-13-1-2-14(18)16(13)4-6-22-8-10-24-12-11-23-9-7-21-5-3-15(19)20/h1-2H,3-12H2,(H,19,20) |
| InChIKey | BTFZSOVKVDCKQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
