For research use only. Not for therapeutic Use.
Mal-PEG4-acid is a PEG-based PROTAC linker can be used in the synthesis of PROTACs.
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein.PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins.
| CAS Number | 518044-41-2 |
| Synonyms | 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| Molecular Formula | C15H23NO8 |
| Purity | ≥95% |
| InChI | InChI=1S/C15H23NO8/c17-13-1-2-14(18)16(13)4-6-22-8-10-24-12-11-23-9-7-21-5-3-15(19)20/h1-2H,3-12H2,(H,19,20) |
| InChIKey | BTFZSOVKVDCKQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |