For research use only. Not for therapeutic Use.
Mal-PEG2-alcohol（Cat No.:I015720）is a short, heterobifunctional polyethylene glycol linker featuring a maleimide group on one end and a terminal hydroxyl group on the other. The maleimide moiety allows selective and stable conjugation with thiol groups, while the hydroxyl group provides a versatile handle for further chemical derivatization or functionalization. The PEG2 spacer enhances solubility, imparts flexibility, and minimizes steric hindrance, ensuring efficient reactivity in both aqueous and organic media. This reagent is widely applied in protein modification, drug delivery systems, and biomaterial surface engineering.
| CAS Number | 34321-81-8 |
| Synonyms | 1-[2-(2-hydroxyethoxy)ethyl]pyrrole-2,5-dione |
| Molecular Formula | C8H11NO4 |
| Purity | ≥95% |
| IUPAC Name | 1-[2-(2-hydroxyethoxy)ethyl]pyrrole-2,5-dione |
| InChI | InChI=1S/C8H11NO4/c10-4-6-13-5-3-9-7(11)1-2-8(9)12/h1-2,10H,3-6H2 |
| InChIKey | IIYLRYHFPWHINS-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
