For research use only. Not for therapeutic Use.
Mal-GGG-Bal-NHS ester (Cat No.: I040126) is a reactive compound used in bioconjugation and drug development. The NHS ester group (N-hydroxysuccinimide) is highly reactive with amine groups, enabling efficient conjugation to peptides, proteins, or other biomolecules. The Mal (maleimide) group allows for selective conjugation with thiol-containing molecules, while GGG (glycine-glycine-glycine) and Bal (benzylamine) linkers provide stability and flexibility in the conjugation process. This compound is often utilized in the synthesis of targeted therapeutics, antibody-drug conjugates, or biomolecule-labeling applications.
| CAS Number | 1193111-65-7 |
| Synonyms | (2,5-dioxopyrrolidin-1-yl) 3-[[2-[[2-[[2-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]acetyl]amino]acetyl]amino]acetyl]amino]propanoate |
| Molecular Formula | C21H26N6O10 |
| Purity | ≥95% |
| InChI | InChI=1S/C21H26N6O10/c28-13(2-1-9-26-17(32)3-4-18(26)33)23-11-15(30)25-12-16(31)24-10-14(29)22-8-7-21(36)37-27-19(34)5-6-20(27)35/h3-4H,1-2,5-12H2,(H,22,29)(H,23,28)(H,24,31)(H,25,30) |
| InChIKey | NFJWAGOKMMRHHY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCNC(=O)CNC(=O)CNC(=O)CNC(=O)CCCN2C(=O)C=CC2=O |
| Reference | [1]. Beck A, et, al. Strategies and challenges for the next generation of antibody-drug conjugates. Nat Rev Drug Discov. 2017 May;16(5):315-337. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |