For research use only. Not for therapeutic Use.
Magnesium chlorate(Cat No.:M055713), with the chemical formula Mg(ClO₃)₂, is an inorganic compound known for its high solubility in water and hygroscopic nature. This white crystalline solid is a powerful oxidizing agent used in various applications such as a source of oxygen in chemical synthesis and pyrotechnics, where it contributes to the intensity and stability of colors in fireworks. In addition, magnesium chlorate is used in the paper and pulp industry for bleaching processes.
| CAS Number | 10326-21-3 |
| Molecular Formula | Mg(ClO3)2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | magnesium;dichlorate |
| InChI | InChI=1S/2ClHO3.Mg/c2*2-1(3)4;/h2*(H,2,3,4);/q;;+2/p-2 |
| InChIKey | NNNSKJSUQWKSAM-UHFFFAOYSA-L |
| SMILES | [O-]Cl(=O)=O.[O-]Cl(=O)=O.[Mg+2] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |