For research use only. Not for therapeutic Use.
<p>
Mafosfamide Sodium Salt (CAS 84211-05-2) <span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;"><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;"> <span style="font-variant-ligatures: normal;">is a cyclophosphamide analog that induces apoptosis and acts as an antitumor agent in vitro. </span></span></span></span><span style="orphans: 2; widows: 2; font-family: arial, helvetica, sans-serif;">It alkylates DNA, forming DNA cross-links and inhibiting DNA synthesis. </span></p>
| CAS Number | 84211-05-2 |
| Synonyms | rel-2-[[(2R,4R)-2-[Bis(2-chloroethyl)amino]tetrahydro-2-oxido-2H-1,3,2-oxazaphosphorin-4-yl]thio]ethanesulfonic Acid Sodium; Mafosfamid Sodium; Z 7557; cis-Mafosfamide Sodium; |
| Molecular Formula | C₉H₁₈Cl₂N₂NaO₅PS₂ |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | sodium;2-[[(2R,4R)-2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2$l^{5}-oxazaphosphinan-4-yl]sulfanyl]ethanesulfonate |
| InChI | InChI=1S/C9H19Cl2N2O5PS2.Na/c10-2-4-13(5-3-11)19(14)12-9(1-6-18-19)20-7-8-21(15,16)17;/h9H,1-8H2,(H,12,14)(H,15,16,17);/q;+1/p-1/t9-,19-;/m1./s1 |
| InChIKey | LHXWPBHSZFEANP-KCPSBDNSSA-M |
| SMILES | C1COP(=O)(NC1SCCS(=O)(=O)[O-])N(CCCl)CCCl.[Na+] |
| Reference | <p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |