For research use only. Not for therapeutic Use.
Macropa-NH2 diester(CAT: I016230) is an aminated derivative of the macropa chelator, functionalized with two ester groups that enable versatile conjugation and modification strategies. As a high-affinity chelating scaffold, macropa is specifically engineered for the stable coordination of large radiometals such as actinium-225, making it particularly valuable in targeted alpha therapy (TAT) research. The pendant amine group allows further functionalization, including coupling to peptides, antibodies, or small-molecule inhibitors, while the diester moieties facilitate controlled derivatization. With excellent stability, biocompatibility, and tunability, Macropa-NH2 diester serves as a key intermediate for radiopharmaceutical development and advanced applications in oncology and nuclear medicine research.
| CAS Number | 2146091-22-5 |
| Synonyms | ethyl 4-amino-6-[[16-[(6-methoxycarbonylpyridin-2-yl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]pyridine-2-carboxylate |
| Molecular Formula | C29H43N5O8 |
| Purity | ≥95% |
| IUPAC Name | ethyl 4-amino-6-[[16-[(6-methoxycarbonylpyridin-2-yl)methyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]methyl]pyridine-2-carboxylate |
| InChI | InChI=1S/C29H43N5O8/c1-3-42-29(36)27-20-23(30)19-25(32-27)22-34-9-13-40-17-15-38-11-7-33(8-12-39-16-18-41-14-10-34)21-24-5-4-6-26(31-24)28(35)37-2/h4-6,19-20H,3,7-18,21-22H2,1-2H3,(H2,30,32) |
| InChIKey | NXIKTSBSIRKUDI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=N1)CN2CCOCCOCCN(CCOCCOCC2)CC3=NC(=CC=C3)C(=O)OC)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
