For research use only. Not for therapeutic Use.
Macromerine hydrochloride(Cat No.:I031445)is a synthetic compound studied for its potential therapeutic properties. It belongs to a class of molecules known for their large, macromolecular structure, which can interact with biological targets such as enzymes, receptors, and ion channels. While detailed information on its specific applications is still limited, macromerine hydrochloride has been investigated in the context of cancer, neurodegenerative diseases, and other disorders where molecular modulation plays a crucial role. Ongoing research aims to evaluate its pharmacological profile, safety, efficacy, and potential clinical uses in treating various health conditions.
CAS Number | 51012-68-1 |
Synonyms | (+/-)-Macromerine hydrochloride; (+/-)-Macromerine HCl; Macromerine hydrochloride; Macromerine HCl |
Molecular Formula | C12H20ClNO3 |
Purity | 98% |
Solubility | To be determined |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethanol;hydrochloride |
InChI | InChI=1S/C12H19NO3.ClH/c1-13(2)8-10(14)9-5-6-11(15-3)12(7-9)16-4;/h5-7,10,14H,8H2,1-4H3;1H |
InChIKey | UXWIETBYRXIRRV-UHFFFAOYSA-N |
SMILES | CN(C)CC(C1=CC(=C(C=C1)OC)OC)O.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |