For research use only. Not for therapeutic Use.
MAC glucuronide linker-1(Cat No.:I017660) is a cleavable linker used in the construction of antibody-drug conjugates (ADCs). It consists of a glucuronide moiety that can be selectively cleaved under specific conditions, releasing the attached drug payload. This linker design allows for targeted drug delivery, where the antibody specifically recognizes and binds to the target antigen, leading to internalization and subsequent release of the drug within the targeted cells. MAC glucuronide linker-1 provides a strategy to enhance the therapeutic efficacy and selectivity of ADCs in various applications, including cancer treatment.
CAS Number | 2222981-71-5 |
Molecular Formula | C₄₂H₄₇N₃O₁₇S |
Purity | ≥95% |
Target | ADC Linker |
IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-[[2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]acetyl]amino]-4-(2-methylsulfonylethylcarbamoyloxymethyl)phenoxy]oxane-2-carboxylate |
InChI | InChI=1S/C42H47N3O17S/c1-23(46)58-35-36(59-24(2)47)38(60-25(3)48)40(62-37(35)39(50)55-5)61-33-16-15-26(21-56-41(51)43-17-18-63(6,53)54)19-32(33)44-34(49)20-45(4)42(52)57-22-31-29-13-9-7-11-27(29)28-12-8-10-14-30(28)31/h7-16,19,31,35-38,40H,17-18,20-22H2,1-6H3,(H,43,51)(H,44,49)/t35-,36-,37-,38+,40+/m0/s1 |
InChIKey | HKCMXFVQNGHVML-KWMSUFDQSA-N |
SMILES | CC(=O)OC1C(C(OC(C1OC(=O)C)OC2=C(C=C(C=C2)COC(=O)NCCS(=O)(=O)C)NC(=O)CN(C)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)OC)OC(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |