For research use only. Not for therapeutic Use.
m-PEG4-phosphonic acid ethyl ester(CAT: I016512) is a monofunctional polyethylene glycol derivative composed of a four-unit PEG spacer terminated with a phosphonic acid ethyl ester group. The PEG4 chain improves aqueous solubility, flexibility, and biocompatibility, while minimizing steric hindrance and nonspecific interactions. The ethyl ester serves as a protected form of the phosphonic acid, allowing controlled deprotection to generate the free acid for strong coordination with metal oxide surfaces such as titanium, zirconium, or iron oxides. This reagent is widely applied in nanomaterial surface modification, biomaterial engineering, and drug delivery research, enabling stable immobilization and hydrophilic surface functionalization.
| CAS Number | 1872433-73-2 |
| Synonyms | 1-[2-[2-(2-diethoxyphosphorylethoxy)ethoxy]ethoxy]-2-methoxyethane |
| Molecular Formula | C13H29O7P |
| Purity | ≥95% |
| IUPAC Name | 1-[2-[2-(2-diethoxyphosphorylethoxy)ethoxy]ethoxy]-2-methoxyethane |
| InChI | InChI=1S/C13H29O7P/c1-4-19-21(14,20-5-2)13-12-18-11-10-17-9-8-16-7-6-15-3/h4-13H2,1-3H3 |
| InChIKey | IJIFYTYZSWFMQQ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CCOCCOCCOCCOC)OCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
