For research use only. Not for therapeutic Use.
m-PEG4-CH₂-acid（Cat No.:I015952）is a monofunctional PEG derivative featuring a methoxy group at one end and a terminal carboxylic acid connected through a PEG₄ spacer. The carboxyl group can be readily activated for coupling with primary amines, hydroxyls, or other nucleophiles to form stable linkages. The methoxy terminus provides hydrophilicity and structural stability, while the PEG₄ chain enhances solubility, flexibility, and biocompatibility. This reagent is particularly useful for surface modification, bioconjugation, nanoparticle functionalization, and drug delivery systems where a single reactive carboxyl group and defined PEG spacer are required.
| CAS Number | 874208-84-1 |
| Synonyms | 4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butanoic acid |
| Molecular Formula | C11H22O6 |
| Purity | ≥95% |
| IUPAC Name | 4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]butanoic acid |
| InChI | InChI=1S/C11H22O6/c1-14-5-6-16-9-10-17-8-7-15-4-2-3-11(12)13/h2-10H2,1H3,(H,12,13) |
| InChIKey | HKQFGVZYAYHZJS-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
