LYS-LYS-LYS(Cat No.:M064355) represents a tripeptide composed of three lysine residues linked together. Lysine is an essential amino acid known for its positive charge and role in protein synthesis. This particular tripeptide, with a sequence of three lysines, has significant biological implications, particularly in gene expression and cellular signaling due to its ability to bind to negatively charged molecules like DNA or phospholipids. Such peptides are studied for their potential in drug delivery systems, as their positive charge can facilitate cellular uptake. They also hold potential in research focused on understanding protein interactions and enzyme function.
Catalog Number | M064355 |
CAS Number | 13184-14-0 |
Molecular Formula | C18H38N6O4 |
Purity | 95% |
Storage | Store at RT |
IUPAC Name | (2S)-6-amino-2-[[(2S)-6-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]hexanoyl]amino]hexanoic acid |
InChI | InChI=1S/C18H38N6O4/c19-10-4-1-7-13(22)16(25)23-14(8-2-5-11-20)17(26)24-15(18(27)28)9-3-6-12-21/h13-15H,1-12,19-22H2,(H,23,25)(H,24,26)(H,27,28)/t13-,14-,15-/m0/s1 |
InChIKey | WBSCNDJQPKSPII-KKUMJFAQSA-N |
SMILES | C(CCN)CC(C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)O)N |