For research use only. Not for therapeutic Use.
LYG-202(CAT: R067077) is a synthetic flavonoid compound exhibiting potent anti-angiogenic and antitumor activity. It effectively inhibits VEGF-induced endothelial cell migration and tube formation in HUVEC models, highlighting its role in suppressing tumor-associated angiogenesis. Beyond vascular inhibition, LYG-202 demonstrates the ability to induce apoptosis in various cancer cell lines, making it a promising candidate for targeted anticancer therapies. Its dual action on angiogenesis and tumor cell survival positions LYG-202 as a valuable agent for preclinical oncology research. This compound is ideal for investigating mechanisms of tumor vascularization, apoptosis induction, and the development of novel anti-cancer therapeutics.
CAS Number | 1175077-25-4 |
Synonyms | 5-hydroxy-8-methoxy-7-[4-(4-methylpiperazin-1-yl)butoxy]-2-phenylchromen-4-one |
Molecular Formula | C25H30N2O5 |
Purity | ≥95% |
IUPAC Name | 5-hydroxy-8-methoxy-7-[4-(4-methylpiperazin-1-yl)butoxy]-2-phenylchromen-4-one |
InChI | InChI=1S/C25H30N2O5/c1-26-11-13-27(14-12-26)10-6-7-15-31-22-17-20(29)23-19(28)16-21(18-8-4-3-5-9-18)32-25(23)24(22)30-2/h3-5,8-9,16-17,29H,6-7,10-15H2,1-2H3 |
InChIKey | ICGYSEWPMDWBIL-UHFFFAOYSA-N |
SMILES | CN1CCN(CC1)CCCCOC2=C(C3=C(C(=C2)O)C(=O)C=C(O3)C4=CC=CC=C4)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |