For research use only. Not for therapeutic Use.
LY88074 (CAT: R056466) is a structural analog of Raloxifene, a selective estrogen receptor modulator (SERM), distinguished by the absence of Raloxifene’s basic aminoethylpiperidine side chain. This modification significantly alters its pharmacological properties, reducing its affinity for bone tissue while retaining measurable interaction with the collagen matrix. Although less effective in bone binding compared to Raloxifene, LY88074 remains valuable for exploring non-estrogen receptor–mediated mechanisms of bone health. It provides a chemical tool for investigating how structural modifications influence SERM activity, tissue distribution, and mechanical effects on bone, supporting research in osteoporosis, bone matrix biology, and selective receptor modulation.
| CAS Number | 177744-96-6 |
| Synonyms | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-hydroxyphenyl)methanone |
| Molecular Formula | C21H14O4S |
| Purity | ≥95% |
| IUPAC Name | [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]-(4-hydroxyphenyl)methanone |
| InChI | InChI=1S/C21H14O4S/c22-14-5-1-12(2-6-14)20(25)19-17-10-9-16(24)11-18(17)26-21(19)13-3-7-15(23)8-4-13/h1-11,22-24H |
| InChIKey | CTMKIRXPVZYQJP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C3=C(S2)C=C(C=C3)O)C(=O)C4=CC=C(C=C4)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
