For research use only. Not for therapeutic Use.
LY487379（Cat No.:I044118）is a selective positive allosteric modulator (PAM) of the metabotropic glutamate receptor 2 (mGluR2), developed to enhance glutamatergic signaling regulation in the central nervous system. Unlike direct agonists, it binds allosterically to increase the receptor’s response to endogenous glutamate without triggering activation alone. LY487379 is widely studied for its potential in treating psychiatric and neurological disorders, including anxiety, schizophrenia, and depression. Its ability to fine-tune synaptic transmission while minimizing side effects makes it a valuable pharmacological tool and a promising candidate in neuropsychiatric drug development.
| CAS Number | 353231-17-1 |
| Synonyms | 2,2,2-trifluoro-N-[4-(2-methoxyphenoxy)phenyl]-N-(pyridin-3-ylmethyl)ethanesulfonamide |
| Molecular Formula | C21H19F3N2O4S |
| Purity | ≥95% |
| IUPAC Name | 2,2,2-trifluoro-N-[4-(2-methoxyphenoxy)phenyl]-N-(pyridin-3-ylmethyl)ethanesulfonamide |
| InChI | InChI=1S/C21H19F3N2O4S/c1-29-19-6-2-3-7-20(19)30-18-10-8-17(9-11-18)26(14-16-5-4-12-25-13-16)31(27,28)15-21(22,23)24/h2-13H,14-15H2,1H3 |
| InChIKey | ALMACYDZFBMGOR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1OC2=CC=C(C=C2)N(CC3=CN=CC=C3)S(=O)(=O)CC(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
