For research use only. Not for therapeutic Use.
LY2801653 2HCl(CAT: I000768) is a potent, orally bioavailable small-molecule inhibitor targeting c-MET kinase, a critical regulator in tumor growth, metastasis, and angiogenesis. By inhibiting the c-MET signaling pathway, it disrupts oncogenic processes associated with various cancers, including hepatocellular carcinoma, non-small cell lung cancer, and gastric cancer. Its high selectivity and efficacy make it a valuable tool for oncology research, particularly in studying tumor progression and therapeutic resistance. LY2801653 2HCl is instrumental in advancing cancer pharmacology, offering insights into targeted therapies for improving clinical outcomes.
| CAS Number | 1206801-37-7 |
| Synonyms | N-[3-fluoro-4-[1-methyl-6-(1H-pyrazol-4-yl)indazol-5-yl]oxyphenyl]-1-(4-fluorophenyl)-6-methyl-2-oxopyridine-3-carboxamide;dihydrochloride |
| Molecular Formula | C30H24Cl2F2N6O3 |
| Purity | ≥95% |
| Target | c-Met/HGFR |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IC50 | 2 nM (Ki value) [1] |
| IUPAC Name | N-[3-fluoro-4-[1-methyl-6-(1H-pyrazol-4-yl)indazol-5-yl]oxyphenyl]-1-(4-fluorophenyl)-6-methyl-2-oxopyridine-3-carboxamide;dihydrochloride |
| InChI | InChI=1S/C30H22F2N6O3.2ClH/c1-17-3-9-23(30(40)38(17)22-7-4-20(31)5-8-22)29(39)36-21-6-10-27(25(32)12-21)41-28-11-18-16-35-37(2)26(18)13-24(28)19-14-33-34-15-19;;/h3-16H,1-2H3,(H,33,34)(H,36,39);2*1H |
| InChIKey | NNYNNMGUBHQQLZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C(=O)N1C2=CC=C(C=C2)F)C(=O)NC3=CC(=C(C=C3)OC4=C(C=C5C(=C4)C=NN5C)C6=CNN=C6)F.Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
