For research use only. Not for therapeutic Use.
Lupiwighteone（Cat No.:M135845）is an isoflavonoid compound predominantly found in Lupinus species. As a natural polyphenolic metabolite, it belongs to the flavonoid family and exhibits diverse biological activities. Research suggests lupiwighteone may possess antioxidant, anti-inflammatory, and anticancer properties, contributing to its potential role in therapeutic development. It is also studied for its effects on estrogenic activity and cell signaling pathways, making it relevant in endocrinology and metabolic disease research. Lupiwighteone is widely used as a reference standard in phytochemistry, pharmacology, and natural product drug discovery studies.
| CAS Number | 104691-86-3 |
| Synonyms | 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)chromen-4-one |
| Molecular Formula | C20H18O5 |
| Purity | ≥95% |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-(3-methylbut-2-enyl)chromen-4-one |
| InChI | InChI=1S/C20H18O5/c1-11(2)3-8-14-16(22)9-17(23)18-19(24)15(10-25-20(14)18)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 |
| InChIKey | YGCCASGFIOIXIN-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=C(C=C1O)O)C(=O)C(=CO2)C3=CC=C(C=C3)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
