For research use only. Not for therapeutic Use.
Luciferase-IN-1（Cat No.:M120230）is a small-molecule inhibitor designed to selectively suppress luciferase enzyme activity, commonly used in bioluminescence assays and imaging studies. By inhibiting the oxidative reaction of luciferin catalyzed by luciferase, it allows researchers to control or modulate luminescent signals in biological systems. Luciferase-IN-1 is valuable in validating reporter gene systems, studying signal transduction pathways, and minimizing background luminescence in experimental setups. Its specificity and potency make it an essential tool in high-throughput screening, gene expression analysis, and drug discovery involving luciferase-based bioluminescent assays.
| CAS Number | 10205-56-8 |
| Synonyms | 4-(1,3-benzothiazol-2-yl)-N,N-dimethylaniline |
| Molecular Formula | C15H14N2S |
| Purity | ≥95% |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N,N-dimethylaniline |
| InChI | InChI=1S/C15H14N2S/c1-17(2)12-9-7-11(8-10-12)15-16-13-5-3-4-6-14(13)18-15/h3-10H,1-2H3 |
| InChIKey | HYKGLCSXVAAXNC-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C2=NC3=CC=CC=C3S2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
