For research use only. Not for therapeutic Use.
LT175（Cat No.:R027473）is a selective and potent inhibitor of diacylglycerol kinase alpha (DGKα), an enzyme that regulates lipid signaling by converting diacylglycerol (DAG) into phosphatidic acid (PA). By inhibiting DGKα, LT175 increases intracellular DAG levels, modulating signaling pathways involved in cell proliferation, survival, and immune responses. LT175 has shown promise in cancer research, particularly in enhancing T-cell activity and suppressing tumor growth, positioning it as a potential immuno-oncology agent. It is a valuable tool for studying lipid-mediated signal transduction and exploring therapeutic strategies targeting immune evasion in cancer.
| CAS Number | 862901-87-9 |
| Synonyms | (2S)-3-phenyl-2-(4-phenylphenoxy)propanoic acid |
| Molecular Formula | C21H18O3 |
| Purity | ≥95% |
| IUPAC Name | (2S)-3-phenyl-2-(4-phenylphenoxy)propanoic acid |
| InChI | InChI=1S/C21H18O3/c22-21(23)20(15-16-7-3-1-4-8-16)24-19-13-11-18(12-14-19)17-9-5-2-6-10-17/h1-14,20H,15H2,(H,22,23)/t20-/m0/s1 |
| InChIKey | TZTPJJNNACUQQR-FQEVSTJZSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)OC2=CC=C(C=C2)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
