For research use only. Not for therapeutic Use.
LRE1(Cat No.:I019647)is an experimental compound being studied for its potential therapeutic applications, particularly in the field of oncology or inflammation. It functions by targeting specific receptors or enzymes involved in disease processes like tumor growth or immune modulation. LRE1 is thought to have effects on cell signaling, potentially inhibiting cancer cell proliferation or modulating inflammatory responses. Currently, it is undergoing preclinical or early clinical trials to evaluate its safety, efficacy, and pharmacokinetic profile. More research is required to fully understand its mechanism of action and potential as a treatment option.
CAS Number | 1252362-53-0 |
Molecular Formula | C₁₂H₁₃ClN₄S |
Purity | ≥95% |
Target | Adenylate Cyclase |
IUPAC Name | 6-chloro-4-N-cyclopropyl-4-N-(thiophen-2-ylmethyl)pyrimidine-2,4-diamine |
InChI | InChI=1S/C12H13ClN4S/c13-10-6-11(16-12(14)15-10)17(8-3-4-8)7-9-2-1-5-18-9/h1-2,5-6,8H,3-4,7H2,(H2,14,15,16) |
InChIKey | PDWZXKSZLRVSEH-UHFFFAOYSA-N |
SMILES | C1CC1N(CC2=CC=CS2)C3=CC(=NC(=N3)N)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |