For research use only. Not for therapeutic Use.
LpxC-IN-10(Cat No.:I043425)is a small molecule inhibitor of LpxC, an enzyme crucial for the biosynthesis of lipopolysaccharides in Gram-negative bacteria. By inhibiting LpxC, LpxC-IN-10 disrupts the formation of the bacterial outer membrane, making the bacteria more susceptible to host immune responses and antibiotics. This compound has shown potential in preclinical studies as an effective treatment for infections caused by multi-drug-resistant Gram-negative bacteria. LpxC-IN-10 represents a promising strategy in the development of novel antibacterial therapies, addressing the growing challenge of antibiotic resistance.
| CAS Number | 2413574-64-6 |
| Synonyms | 1-[(2S)-3-(5-hydroxy-6-oxo-1H-pyrimidin-4-yl)-2-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]propyl]azetidine-3-carbonitrile |
| Molecular Formula | C30H31N5O3 |
| Purity | ≥95% |
| IUPAC Name | 1-[(2S)-3-(5-hydroxy-6-oxo-1H-pyrimidin-4-yl)-2-[4-[2-[4-(morpholin-4-ylmethyl)phenyl]ethynyl]phenyl]propyl]azetidine-3-carbonitrile |
| InChI | InChI=1S/C30H31N5O3/c31-16-25-18-35(19-25)20-27(15-28-29(36)30(37)33-21-32-28)26-9-7-23(8-10-26)2-1-22-3-5-24(6-4-22)17-34-11-13-38-14-12-34/h3-10,21,25,27,36H,11-15,17-20H2,(H,32,33,37)/t27-/m1/s1 |
| InChIKey | RVSQDMFHNYKDPF-HHHXNRCGSA-N |
| SMILES | C1COCCN1CC2=CC=C(C=C2)C#CC3=CC=C(C=C3)[C@H](CC4=C(C(=O)NC=N4)O)CN5CC(C5)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |