For research use only. Not for therapeutic Use.
Loureirin D（Cat No.:I044823）is a dihydrochalcone compound isolated from Dracaena cochinchinensis, commonly known as dragon’s blood, a traditional medicinal resin. It features a characteristic flavonoid backbone with hydroxyl and methoxy substitutions that contribute to its pharmacological activity. Loureirin D exhibits anti-inflammatory, antioxidant, and anticoagulant properties, with notable potential in promoting blood circulation and wound healing. It has also been studied for its effects on platelet aggregation and vascular relaxation. As part of the loureirin family, Loureirin D is of interest in both traditional Chinese medicine and modern therapeutic research.
| CAS Number | 119425-91-1 |
| Synonyms | 3-(2,4-dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)propan-1-one |
| Molecular Formula | C16H16O5 |
| Purity | ≥95% |
| IUPAC Name | 3-(2,4-dihydroxy-6-methoxyphenyl)-1-(4-hydroxyphenyl)propan-1-one |
| InChI | InChI=1S/C16H16O5/c1-21-16-9-12(18)8-15(20)13(16)6-7-14(19)10-2-4-11(17)5-3-10/h2-5,8-9,17-18,20H,6-7H2,1H3 |
| InChIKey | AQMBVNGTZRFEPF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1CCC(=O)C2=CC=C(C=C2)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
