For research use only. Not for therapeutic Use.
Lotaustralin(CAT: I016780) is a cyanogenic glycoside commonly found in plants such as Lotus australis, cassava (Manihot esculenta), and lima beans. Upon enzymatic hydrolysis, it releases hydrogen cyanide, making it an important compound in toxicological and food safety studies. Research on Lotaustralin focuses on its metabolic pathways, enzymatic degradation, and potential toxicity in humans and animals. It is used to study cyanogenesis, plant defense mechanisms, and dietary exposure risks from cyanogenic foods. Lotaustralin is a valuable tool compound for investigations in agricultural safety, environmental toxicology, and biochemical pathways of cyanogenic glycosides.
| CAS Number | 1973415-50-7 |
| Synonyms | 2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanenitrile |
| Molecular Formula | C11H19NO6 |
| Purity | ≥95% |
| IUPAC Name | 2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanenitrile |
| InChI | InChI=1S/C11H19NO6/c1-3-11(2,5-12)18-10-9(16)8(15)7(14)6(4-13)17-10/h6-10,13-16H,3-4H2,1-2H3/t6-,7-,8+,9-,10+,11?/m1/s1 |
| InChIKey | WEWBWVMTOYUPHH-GXUZYPEDSA-N |
| SMILES | CCC(C)(C#N)OC1C(C(C(C(O1)CO)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
