For research use only. Not for therapeutic Use.
Loracarbef hydrate（Cat No.:M016011）is a β-lactam antibiotic belonging to the carbacephem class, structurally related to cephalosporins. It exhibits broad-spectrum antibacterial activity by inhibiting bacterial cell wall synthesis through binding to penicillin-binding proteins (PBPs). The hydrate form enhances stability and solubility for experimental and pharmaceutical applications. Loracarbef is effective against a range of Gram-positive and Gram-negative pathogens, making it useful in studies of antimicrobial resistance and β-lactam pharmacology. Researchers employ loracarbef hydrate in microbiology and medicinal chemistry to investigate antibiotic mechanisms, structure–activity relationships, and therapeutic development.
| CAS Number | 121961-22-6 |
| Synonyms | (6R,7S)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrate |
| Molecular Formula | C16H18ClN3O5 |
| Purity | ≥95% |
| IUPAC Name | (6R,7S)-7-[[(2R)-2-amino-2-phenylacetyl]amino]-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrate |
| InChI | InChI=1S/C16H16ClN3O4.H2O/c17-9-6-7-10-12(15(22)20(10)13(9)16(23)24)19-14(21)11(18)8-4-2-1-3-5-8;/h1-5,10-12H,6-7,18H2,(H,19,21)(H,23,24);1H2/t10-,11-,12+;/m1./s1 |
| InChIKey | GPYKKBAAPVOCIW-HSASPSRMSA-N |
| SMILES | C1CC(=C(N2[C@H]1[C@@H](C2=O)NC(=O)[C@@H](C3=CC=CC=C3)N)C(=O)O)Cl.O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
