For research use only. Not for therapeutic Use.
Loliolide (Cat.No:R061316) is a germination inhibitor that is isolated from Sargassum ringgoldianum subsp. coreanum. Loliolide exhibits antioxidant activity to protect the cells against H2O2-induced cell damage or apoptosis.
| CAS Number | 5989-02-6 |
| Molecular Formula | C11H16O3 |
| Purity | ≥95% |
| Target | Plants |
| Storage | -20°C |
| IUPAC Name | (6S,7aR)-6-hydroxy-4,4,7a-trimethyl-6,7-dihydro-5H-1-benzofuran-2-one |
| InChI | InChI=1S/C11H16O3/c1-10(2)5-7(12)6-11(3)8(10)4-9(13)14-11/h4,7,12H,5-6H2,1-3H3/t7-,11+/m0/s1 |
| InChIKey | XEVQXKKKAVVSMW-WRWORJQWSA-N |
| SMILES | CC1(CC(CC2(C1=CC(=O)O2)C)O)C |
| Reference | <p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |