For research use only. Not for therapeutic Use.
LNP Lipid-3(Cat No.:I041175)is a lipid nanoparticle (LNP) formulation designed to enhance the delivery of mRNA-based therapeutics. It plays a crucial role in stabilizing and facilitating the efficient encapsulation and delivery of mRNA to target cells. LNP Lipid-3 contains specialized lipids that improve cellular uptake and endosomal release, ensuring the safe and effective delivery of therapeutic mRNA. This formulation is being explored for its potential in gene therapy, vaccines, and other RNA-based treatments. Research is ongoing to assess its effectiveness, stability, and safety in various biomedical applications.
| CAS Number | 2648693-32-5 |
| Synonyms | 6-[6-(2-hexyldecanoyloxy)hexyl-(3-imidazol-1-ylpropyl)amino]hexyl 2-hexyldecanoate |
| Molecular Formula | C50H95N3O4 |
| Purity | ≥95% |
| IUPAC Name | 6-[6-(2-hexyldecanoyloxy)hexyl-(3-imidazol-1-ylpropyl)amino]hexyl 2-hexyldecanoate |
| InChI | InChI=1S/C50H95N3O4/c1-5-9-13-17-19-27-36-47(34-25-15-11-7-3)49(54)56-44-31-23-21-29-39-52(41-33-42-53-43-38-51-46-53)40-30-22-24-32-45-57-50(55)48(35-26-16-12-8-4)37-28-20-18-14-10-6-2/h38,43,46-48H,5-37,39-42,44-45H2,1-4H3 |
| InChIKey | OXCZMFBUQLLUCE-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCN(CCCCCCOC(=O)C(CCCCCC)CCCCCCCC)CCCN1C=CN=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |