For research use only. Not for therapeutic Use.
LM-41(CAT: I040292) is a potent TEAD (transcriptional enhanced associate domain) inhibitor derived from flufenamic acid, designed to disrupt TEAD-mediated transcriptional activity within the Hippo signaling pathway. LM-41 effectively downregulates key TEAD target genes, including CTGF, Cyr61, Axl, and NF2, which are associated with cell proliferation, survival, and metastasis. It significantly inhibits the migration of MDA-MB-231 human breast cancer cells, highlighting its potential as an anti-metastatic agent. LM-41 is a valuable chemical probe for investigating TEAD function and Hippo pathway regulation in cancer biology.
| CAS Number | 2996821-30-6 |
| Synonyms | 4-fluoro-2-(3-phenylanilino)benzoic acid |
| Molecular Formula | C19H14FNO2 |
| Purity | ≥95% |
| IUPAC Name | 4-fluoro-2-(3-phenylanilino)benzoic acid |
| InChI | InChI=1S/C19H14FNO2/c20-15-9-10-17(19(22)23)18(12-15)21-16-8-4-7-14(11-16)13-5-2-1-3-6-13/h1-12,21H,(H,22,23) |
| InChIKey | JGUSPMKKPPHSQY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)NC3=C(C=CC(=C3)F)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
