For research use only. Not for therapeutic Use.
Liriodenine (Cat No.: R014726) is a naturally occurring alkaloid found in various plant species, used in pharmaceutical and biochemical research. Known for its potential anticancer, antimicrobial, and antifungal properties, it is essential for studying the pharmacological activities of natural compounds. This compound aids in the development of novel therapeutic agents, ensuring precise and reliable results in advanced drug discovery and medicinal chemistry research.
CAS Number | 475-75-2 |
Molecular Formula | C17H9NO3 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | 3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,9,11,14,16,18-octaen-13-one |
InChI | InChI=1S/C17H9NO3/c19-16-11-4-2-1-3-10(11)14-13-9(5-6-18-15(13)16)7-12-17(14)21-8-20-12/h1-7H,8H2 |
InChIKey | MUMCCPUVOAUBAN-UHFFFAOYSA-N |
SMILES | C1OC2=C(O1)C3=C4C(=C2)C=CN=C4C(=O)C5=CC=CC=C53 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |