For research use only. Not for therapeutic Use.
| CAS Number | 96829-59-3 |
| Synonyms | N-Formyl-L-leucine (1S,3Z,6Z)-1-[[(2S,3S)-3-Hexyl-4-oxo-2-oxetanyl]methyl]-3,6-?dodecadien-1-yl Ester; N-Formyl-L-leucine [2S-[2α(1R*,3Z,6Z),3β]]-1-?[(3-Hexyl-4-oxo-2-oxetanyl)methyl]-3,6-dodecadienyl Ester; (-)-Lipstatin; |
| Molecular Formula | C29H49NO5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [(2S)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]trideca-4,7-dien-2-yl] (2S)-2-formamido-4-methylpentanoate |
| InChI | InChI=1S/C29H49NO5/c1-5-7-9-11-12-13-14-15-16-18-24(34-29(33)26(30-22-31)20-23(3)4)21-27-25(28(32)35-27)19-17-10-8-6-2/h12-13,15-16,22-27H,5-11,14,17-21H2,1-4H3,(H,30,31)/t24-,25-,26-,27-/m0/s1 |
| InChIKey | OQMAKWGYQLJJIA-FWEHEUNISA-N |
| SMILES | CCCCCCC1C(OC1=O)CC(CC=CCC=CCCCCC)OC(=O)C(CC(C)C)NC=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |