For research use only. Not for therapeutic Use.
Lipid 5（Cat No.:I030843）is a synthetic ionizable amino lipid designed for use in lipid nanoparticle (LNP) formulations for mRNA delivery. Structurally engineered to enhance cellular uptake and endosomal escape, it becomes positively charged in acidic environments, facilitating mRNA release into the cytoplasm. Lipid 5-based LNPs have demonstrated superior transfection efficiency, particularly in immune cells, outperforming traditional formulations like MC3. They also support co-delivery of multiple mRNAs, making them ideal for applications in cancer immunotherapy and mRNA vaccine development. Lipid 5 represents a next-generation tool for efficient and targeted nucleic acid delivery.
| CAS Number | 2089251-33-0 |
| Synonyms | nonyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]octanoate |
| Molecular Formula | C44H87NO5 |
| Purity | ≥95% |
| IUPAC Name | nonyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-(2-hydroxyethyl)amino]octanoate |
| InChI | InChI=1S/C44H87NO5/c1-4-7-10-13-16-25-32-41-49-43(47)35-28-21-17-23-30-37-45(39-40-46)38-31-24-18-22-29-36-44(48)50-42(33-26-19-14-11-8-5-2)34-27-20-15-12-9-6-3/h42,46H,4-41H2,1-3H3 |
| InChIKey | ABCVHPIKBGRCJA-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
