For research use only. Not for therapeutic Use.
Linzagolix（Cat No.:I030838）is an oral, non-peptide gonadotropin-releasing hormone (GnRH) receptor antagonist developed for the treatment of hormone-dependent gynecological disorders such as uterine fibroids and endometriosis. By competitively inhibiting GnRH receptors in the pituitary gland, Linzagolix suppresses luteinizing hormone (LH) and follicle-stimulating hormone (FSH) secretion, leading to reduced estrogen production. This estrogen-lowering effect helps alleviate pain, heavy menstrual bleeding, and other symptoms associated with these conditions. Unlike GnRH agonists, Linzagolix allows for dose-dependent estrogen suppression, enabling personalized treatment with or without hormone add-back therapy, minimizing hypoestrogenic side effects while maintaining therapeutic efficacy.
| CAS Number | 935283-04-8 |
| Synonyms | 3-[5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-2-fluoro-4-methoxyphenyl]-2,4-dioxo-1H-thieno[3,4-d]pyrimidine-5-carboxylic acid |
| Molecular Formula | C22H15F3N2O7S |
| Purity | ≥95% |
| IUPAC Name | 3-[5-[(2,3-difluoro-6-methoxyphenyl)methoxy]-2-fluoro-4-methoxyphenyl]-2,4-dioxo-1H-thieno[3,4-d]pyrimidine-5-carboxylic acid |
| InChI | InChI=1S/C22H15F3N2O7S/c1-32-14-4-3-10(23)18(25)9(14)7-34-16-6-13(11(24)5-15(16)33-2)27-20(28)17-12(26-22(27)31)8-35-19(17)21(29)30/h3-6,8H,7H2,1-2H3,(H,26,31)(H,29,30) |
| InChIKey | BMAAMIIYNNPHAB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)F)F)COC2=C(C=C(C(=C2)N3C(=O)C4=C(SC=C4NC3=O)C(=O)O)F)OC |
| Reference |
|
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
