For research use only. Not for therapeutic Use.
Linderene acetate(CAT: I016762) is a naturally occurring sesquiterpene derivative isolated from plants of the Lindera genus, traditionally used in herbal medicine. As a volatile terpene ester, it contributes to the characteristic aroma of Lindera species and has been investigated for its potential bioactive properties. Studies suggest sesquiterpene esters like linderene acetate may exhibit anti-inflammatory, antimicrobial, and antioxidant activities, making them relevant in pharmacology and natural product chemistry. In addition to its biological interest, Linderene acetate is valuable in chemotaxonomic profiling, phytochemical analysis, and the study of essential oil constituents. It supports research into plant-derived compounds and their therapeutic potential.
| CAS Number | 26146-28-1 |
| Synonyms | [(1S,2R,9S,10R,12S)-4,9-dimethyl-13-methylidene-6-oxatetracyclo[7.4.0.03,7.010,12]trideca-3(7),4-dien-2-yl] acetate |
| Molecular Formula | C17H20O3 |
| Purity | ≥95% |
| IUPAC Name | [(1S,2R,9S,10R,12S)-4,9-dimethyl-13-methylidene-6-oxatetracyclo[7.4.0.03,7.010,12]trideca-3(7),4-dien-2-yl] acetate |
| InChI | InChI=1S/C17H20O3/c1-8-7-19-13-6-17(4)12-5-11(12)9(2)15(17)16(14(8)13)20-10(3)18/h7,11-12,15-16H,2,5-6H2,1,3-4H3/t11-,12-,15-,16+,17+/m1/s1 |
| InChIKey | ICLTVELXFUIGLS-FBHBFLDISA-N |
| SMILES | CC1=COC2=C1C(C3C(=C)C4CC4C3(C2)C)OC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
