Linderane, isolated from the root of Lindera aggregata, is an irreversible inhibitor cytochrome P450 2C9 (CYP2C9). Linderane has the potential to relieve pain and cramp[1].
| Catalog Number | M056118 |
| CAS Number | 13476-25-0 |
| Synonyms | (4E,12S,13R)-5,10-dimethyl-8,14,16-trioxatetracyclo[10.2.2.01,13.07,11]hexadeca-4,7(11),9-trien-15-one |
| Molecular Formula | C15H16O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C15H16O4/c1-8-4-3-5-15-13(19-15)12(18-14(15)16)11-9(2)7-17-10(11)6-8/h4,7,12-13H,3,5-6H2,1-2H3/b8-4+/t12-,13+,15?/m0/s1 |
| InChIKey | KBMSVODXFLAQNJ-WDIVDLRRSA-N |
| SMILES | CC1=CCCC23C(O2)C(C4=C(C1)OC=C4C)OC3=O |
| Reference | [1]. Wang H, et al. Mechanism-based inactivation of CYP2C9 by linderane. Xenobiotica. 2015;45(12):1037-46. |
