For research use only. Not for therapeutic Use.
Linamarin（Cat No.:R001051）is a naturally occurring cyanogenic glucoside found in plants like cassava, lima beans, and flaxseed. Upon tissue disruption, it is enzymatically hydrolyzed to release hydrogen cyanide (HCN), a toxic compound. Linamarin plays a defensive role in plants, deterring herbivores and pathogens. In humans, improper processing of linamarin-rich foods can lead to cyanide poisoning, associated with diseases such as konzo and tropical ataxic neuropathy. Despite its toxicity, linamarin is studied for its metabolic pathways, detoxification mechanisms, and potential therapeutic applications in controlled contexts, including cancer and neurodegenerative disease research.
| CAS Number | 554-35-8 |
| Synonyms | 2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanenitrile |
| Molecular Formula | C10H17NO6 |
| Purity | ≥95% |
| IUPAC Name | 2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropanenitrile |
| InChI | InChI=1S/C10H17NO6/c1-10(2,4-11)17-9-8(15)7(14)6(13)5(3-12)16-9/h5-9,12-15H,3H2,1-2H3/t5-,6-,7+,8-,9+/m1/s1 |
| InChIKey | QLTCHMYAEJEXBT-ZEBDFXRSSA-N |
| SMILES | CC(C)(C#N)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
