For research use only. Not for therapeutic Use.
Lidocaine-d6 hydrochloride(Cat No.:S000472) is a deuterated version of lidocaine, where six hydrogen atoms are replaced with deuterium. This alteration can enhance the drug’s metabolic stability and is used in pharmacokinetic research to study how deuterium substitution affects the drug’s behavior in the body. Lidocaine is a widely used local anesthetic and antiarrhythmic drug that works by blocking sodium channels, thereby preventing the propagation of nerve impulses. The hydrochloride salt form increases the solubility of lidocaine, facilitating easier administration.
| CAS Number | 2517378-96-8 |
| Molecular Formula | C14H17D6ClN2O |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| IUPAC Name | N-[2,6-bis(trideuteriomethyl)phenyl]-2-(diethylamino)acetamide;hydrochloride |
| InChI | InChI=1S/C14H22N2O.ClH/c1-5-16(6-2)10-13(17)15-14-11(3)8-7-9-12(14)4;/h7-9H,5-6,10H2,1-4H3,(H,15,17);1H/i3D3,4D3; |
| InChIKey | IYBQHJMYDGVZRY-SKCUOGQWSA-N |
| SMILES | CCN(CC)CC(=O)NC1=C(C=CC=C1C)C.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |