LGD-3303 is a selective androgen receptor modulator (SARM) designed to mimic the anabolic effects of testosterone while minimizing androgenic effects, such as those impacting the prostate. SARMs like LGD-3303 are studied for their potential in treating conditions related to muscle wasting, osteoporosis, and hypogonadism without the side effects commonly associated with anabolic steroids. LGD-3303 has shown promise in promoting muscle growth and improving bone density in preclinical studies, making it a candidate for developing therapies aimed at muscle and bone health.
| Catalog Number | I011845 |
| CAS Number | 917891-35-1 |
| Synonyms | LGD 3303; 9-Chloro-2-ethyl-3,6-dihydro-1-methyl-3-(2,2,2-trifluoroethyl)-7H-pyrrolo[3,2-f]quinolin-7-one; |
| Molecular Formula | C16H14ClF3N2O |
| Purity | ≥95% |
| Target | Androgen receptor |
| Storage | RT |
| IUPAC Name | 9-chloro-2-ethyl-1-methyl-3-(2,2,2-trifluoroethyl)-6H-pyrrolo[3,2-f]quinolin-7-one |
| InChI | InChI=1S/C16H14ClF3N2O/c1-3-11-8(2)14-12(22(11)7-16(18,19)20)5-4-10-15(14)9(17)6-13(23)21-10/h4-6H,3,7H2,1-2H3,(H,21,23) |
| InChIKey | OMXGOGXEWUCLFI-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(N1CC(F)(F)F)C=CC3=C2C(=CC(=O)N3)Cl)C |
