For research use only. Not for therapeutic Use.
Levonorgestrel(CAT: A000355) is a synthetic progestogen widely used in hormonal contraception, including emergency contraceptive pills, oral contraceptives, and intrauterine devices (IUDs). It appears as a white to off-white crystalline powder, practically insoluble in water but soluble in organic solvents. Derived from 19-nortestosterone, levonorgestrel binds to progesterone receptors to inhibit ovulation, alter cervical mucus viscosity, and reduce endometrial receptivity, preventing fertilization and implantation. It has high oral bioavailability and long-lasting activity, making it effective at low doses.
| CAS Number | 797-63-7 |
| Synonyms | Norgestrel; 797-63-7; D-Norgestrel; Microval; Postinor |
| Molecular Formula | C21H28O2 |
| Purity | ≥95% |
| Documentation | |
| Target | Apoptosis |
| Solubility | >13.8mg/mL in DMSO |
| Storage | -20°C |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-one |
| InChI | 1S/C21H28O2/c1-3-20-11-9-17-16-8-6-15(22)13-14(16)5-7-18(17)19(20)10-12-21(20,23)4-2/h2,13,16-19,23H,3,5-12H2,1H3/t16-,17+,18+,19-,20-,21-/m0/s1 |
| InChIKey | WWYNJERNGUHSAO-XUDSTZEESA-N |
| SMILES | CCC12CCC3C(C1CCC2(C#C)O)CCC4=CC(=O)CCC34 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |