For research use only. Not for therapeutic Use.
Levofloxacin-d8(Cat No.:R008106), is an isotopically labeled form of the antibiotic drug Levofloxacin. The “d8” in the name indicates that eight hydrogen atoms in the molecule have been replaced with deuterium atoms, a form of hydrogen with an extra neutron. This labeling is done to create a version of the drug with specific isotopic characteristics, often used in research, pharmacokinetic studies, and bioanalytical applications as an internal standard or reference compound. Levofloxacin is part of the fluoroquinolone class of antibiotics and is effective against various bacterial infections.
| CAS Number | 1217716-71-6 |
| Synonyms | (-)-(S)-9-Fluoro-2,3-dihydro-3-methyl-10-(4-methyl-1-piperazinyl-d8)-7-oxo-7H-pyrido[1,2,3-de]-1,4-benzoxazine-6-carboxylic Acid Hemihydrate; |
| Molecular Formula | C18H20FN3O4 |
| Purity | ≥95% |
| Target | Bacterial |
| Storage | -20°C |
| IUPAC Name | (2S)-7-fluoro-2-methyl-6-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| InChI | InChI=1S/C18H20FN3O4/c1-10-9-26-17-14-11(16(23)12(18(24)25)8-22(10)14)7-13(19)15(17)21-5-3-20(2)4-6-21/h7-8,10H,3-6,9H2,1-2H3,(H,24,25)/t10-/m0/s1/i3D2,4D2,5D2,6D2 |
| InChIKey | GSDSWSVVBLHKDQ-FMBBTWBHSA-N |
| SMILES | [2H]C1(C(N(C(C(N1C)([2H])[2H])([2H])[2H])C2=C(C=C3C4=C2OC[C@@H](N4C=C(C3=O)C(=O)O)C)F)([2H])[2H])[2H] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |