For research use only. Not for therapeutic Use.
Levocarnitine (CAT: A000581) is a naturally occurring quaternary ammonium compound (C₇H₁₅NO₃) essential for transporting long-chain fatty acids into the mitochondria for β-oxidation and energy production. Synthesized endogenously from lysine and methionine, it plays a vital role in cellular energy metabolism, particularly in muscle tissue. Levocarnitine supplementation is used therapeutically to treat primary and secondary carnitine deficiencies, certain metabolic disorders, and conditions associated with impaired fatty acid utilization. It may also support exercise performance and recovery. Biologically active in the L-isomer form, levocarnitine is well absorbed and generally well tolerated, making it a key nutrient in both clinical and sports nutrition.
| CAS Number | 541-15-1 |
| Synonyms | L-carnitine; Levocarnitine; Vitamin BT; 541-15-1; (R)-Carnitine; Carnitor |
| Molecular Formula | C7H15NO3 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | (3R)-3-hydroxy-4-(trimethylazaniumyl)butanoate |
| InChI | 1S/C7H15NO3/c1-8(2,3)5-6(9)4-7(10)11/h6,9H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | PHIQHXFUZVPYII-ZCFIWIBFSA-N |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
