For research use only. Not for therapeutic Use.
Leucovorin calcium(Cat No.:A001093)is a form of folinic acid used to enhance the efficacy and reduce the toxicity of certain chemotherapy drugs, particularly methotrexate and 5-fluorouracil (5-FU). It works by rescuing healthy cells from the harmful effects of methotrexate, which inhibits folic acid metabolism. When combined with 5-FU, leucovorin stabilizes the drug’s binding to the enzyme thymidylate synthase, enhancing its cancer-killing effects. Leucovorin calcium is also used to treat certain types of anemia caused by folic acid deficiency. It plays a key role in supportive cancer care.
| CAS Number | 6035-45-6 |
| Synonyms | Folinic acid |
| Molecular Formula | C21H25CaN7O7.5H2O |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | Limited solubility |
| Storage | 3 years -20C powder |
| IUPAC Name | calcium;(2S)-2-[[4-[(2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methylamino]benzoyl]amino]pentanedioate;pentahydrate |
| InChI | InChI=1S/C20H23N7O7.Ca.5H2O/c21-20-25-16-15(18(32)26-20)27(9-28)12(8-23-16)7-22-11-3-1-10(2-4-11)17(31)24-13(19(33)34)5-6-14(29)30;;;;;;/h1-4,9,12-13,22H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,23,25,26,32);;5*1H2/q;+2;;;;;/p-2/t12?,13-;;;;;;/m0....../s1 |
| InChIKey | NPPBLUASYYNAIG-ZIGBGYJWSA-L |
| SMILES | C1C(N(C2=C(N1)N=C(NC2=O)N)C=O)CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].O.O.O.O.O.[Ca+2] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |