For research use only. Not for therapeutic Use.
Letrozole(CAT: A001090) is a potent, non-steroidal aromatase inhibitor that selectively blocks the aromatase enzyme, which converts androgens into estrogens. By reducing estrogen production, Letrozole effectively suppresses estrogen-dependent tumor growth, making it a critical compound in oncology research, particularly in hormone receptor-positive breast cancer studies. It is also utilized to explore estrogen regulation in various biological processes and reproductive health research. Letrozole’s mechanism of action provides valuable insights into hormone-driven cancers and potential therapeutic strategies, supporting the development of targeted treatments aimed at minimizing estrogen-mediated disease progression.
| CAS Number | 112809-51-5 |
| Synonyms | CGS 20267 |
| Molecular Formula | C17H11N5 |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | >14.3mg/mL in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | 4-[(4-cyanophenyl)-(1,2,4-triazol-1-yl)methyl]benzonitrile |
| InChI | InChI=1S/C17H11N5/c18-9-13-1-5-15(6-2-13)17(22-12-20-11-21-22)16-7-3-14(10-19)4-8-16/h1-8,11-12,17H |
| InChIKey | HPJKCIUCZWXJDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(C2=CC=C(C=C2)C#N)N3C=NC=N3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |