For research use only. Not for therapeutic Use.
Leptomycin B (Cat.No:I010486) is a natural compound derived from Streptomyces bacteria. It is a potent inhibitor of nuclear export, specifically targeting the CRM1 protein. By blocking the export of certain proteins from the nucleus, Leptomycin B disrupts critical cellular processes involved in cell proliferation and survival. It has been widely studied for its potential in cancer treatment and as a tool in cell biology research.
| CAS Number | 87081-35-4 |
| Synonyms | Alternative Names: CI 940, LMB |
| Molecular Formula | C₃₃H₄₈O₆ |
| Purity | ≥95% |
| Target | Anti-infection |
| Solubility | Soluble in ethanol (supplied pre-dissolved in anhydrous ethanol, 27μg/ml) |
| Storage | Store at -20℃ |
| IUPAC Name | (2E,5S,6R,7S,9R,10E,12E,15R,16Z,18E)-17-ethyl-6-hydroxy-3,5,7,9,11,15-hexamethyl-19-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]-8-oxononadeca-2,10,12,16,18-pentaenoic acid |
| InChI | InChI=1S/C33H48O6/c1-9-28(14-15-29-24(5)13-16-31(36)39-29)19-22(3)12-10-11-21(2)17-25(6)32(37)27(8)33(38)26(7)18-23(4)20-30(34)35/h10-11,13-17,19-20,22,24-27,29,33,38H,9,12,18H2,1-8H3,(H,34,35)/b11-10+,15-14+,21-17+,23-20+,28-19-/t22-,24+,25-,26+,27-,29+, |
| InChIKey | YACHGFWEQXFSBS-XYERBDPFSA-N |
| SMILES | CCC(=CC(C)CC=CC(=CC(C)C(=O)C(C)C(C(C)CC(=CC(=O)O)C)O)C)C=CC1C(C=CC(=O)O1)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |