For research use only. Not for therapeutic Use.
LEM-14(Cat No.:I030626)is a selective small molecule inhibitor designed to target specific proteins involved in critical cellular processes, particularly in cancer and immune regulation. It works by disrupting key signaling pathways that control cell proliferation, survival, and immune response, showing promise in inhibiting tumor growth and enhancing immune system function. LEM-14 has demonstrated potential in preclinical studies, particularly in overcoming drug resistance and improving the efficacy of existing cancer therapies. Its high specificity and potency make it a valuable tool for developing targeted therapies in cancer and immune-related diseases.
| CAS Number | 1814881-70-3 |
| Synonyms | 2-[[4-[(3R)-1-oxo-3,4-dihydroisochromene-3-carbonyl]piperazin-1-yl]methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| Molecular Formula | C25H26N4O4S |
| Purity | ≥95% |
| IUPAC Name | 2-[[4-[(3R)-1-oxo-3,4-dihydroisochromene-3-carbonyl]piperazin-1-yl]methyl]-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| InChI | InChI=1S/C25H26N4O4S/c30-22-21-17-7-3-4-8-19(17)34-23(21)27-20(26-22)14-28-9-11-29(12-10-28)24(31)18-13-15-5-1-2-6-16(15)25(32)33-18/h1-2,5-6,18H,3-4,7-14H2,(H,26,27,30)/t18-/m1/s1 |
| InChIKey | ZJOXWRFJOUWUKX-GOSISDBHSA-N |
| SMILES | C1CCC2=C(C1)C3=C(S2)N=C(NC3=O)CN4CCN(CC4)C(=O)[C@H]5CC6=CC=CC=C6C(=O)O5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |